C20H18Cl3N3O — CID 44661758
N-(3-chlorophenyl)-2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide chloride (PubChem CID 44661758) has the molecular formula C20H18Cl3N3O and a molecular weight of 422.74 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide chloride.
| Compound Name | N-(3-chlorophenyl)-2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide chloride |
|---|---|
| PubChem CID | 44661758 |
| Molecular Formula | C20H18Cl3N3O |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | N-(3-chlorophenyl)-2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide chloride |
| SMILES | O=C(C[n+]1cc(-c2ccc(Cl)cc2)n2c1CCC2)Nc1cccc(Cl)c1.[Cl-] |
| InChI | InChI=1S/C20H17Cl2N3O.ClH/c21-15-8-6-14(7-9-15)18-12-24(20-5-2-10-25(18)20)13-19(26)23-17-4-1-3-16(22)11-17;/h1,3-4,6-9,11-12H,2,5,10,13H2;1H |
| InChIKey | DIRZHSSMEHFGHI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|