C20H18Cl2N3O+ — CID 1423422
2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-N-phenylacetamide (PubChem CID 1423422) has the molecular formula C20H18Cl2N3O+ and a molecular weight of 387.29 g/mol. Its IUPAC name is 2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-N-phenylacetamide.
| Compound Name | 2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 1423422 |
| Molecular Formula | C20H18Cl2N3O+ |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-N-phenylacetamide |
| SMILES | O=C(C[n+]1cc(-c2ccc(Cl)c(Cl)c2)n2c1CCC2)Nc1ccccc1 |
| InChI | InChI=1S/C20H17Cl2N3O/c21-16-9-8-14(11-17(16)22)18-12-24(20-7-4-10-25(18)20)13-19(26)23-15-5-2-1-3-6-15/h1-3,5-6,8-9,11-12H,4,7,10,13H2/p+1 |
| InChIKey | XXMDQLUOPQMYTK-UHFFFAOYSA-O |
| XLogP | 4.33 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|