C21H20Cl3N3O — CID 44661659
N-benzyl-2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide chloride (PubChem CID 44661659) has the molecular formula C21H20Cl3N3O and a molecular weight of 436.77 g/mol. Its IUPAC name is N-benzyl-2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide chloride.
| Compound Name | N-benzyl-2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide chloride |
|---|---|
| PubChem CID | 44661659 |
| Molecular Formula | C21H20Cl3N3O |
| Molecular Weight | 436.77 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | N-benzyl-2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide chloride |
| SMILES | O=C(C[n+]1cc(-c2ccc(Cl)c(Cl)c2)n2c1CCC2)NCc1ccccc1.[Cl-] |
| InChI | InChI=1S/C21H19Cl2N3O.ClH/c22-17-9-8-16(11-18(17)23)19-13-25(21-7-4-10-26(19)21)14-20(27)24-12-15-5-2-1-3-6-15;/h1-3,5-6,8-9,11,13H,4,7,10,12,14H2;1H |
| InChIKey | DWWGFQXIOFOWKF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.77 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|