C14H14ClN3 — CID 45129490
2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)acetonitrile chloride (PubChem CID 45129490) has the molecular formula C14H14ClN3 and a molecular weight of 259.74 g/mol. Its IUPAC name is 2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)acetonitrile chloride.
| Compound Name | 2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)acetonitrile chloride |
|---|---|
| PubChem CID | 45129490 |
| Molecular Formula | C14H14ClN3 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)acetonitrile chloride |
| SMILES | N#CC[n+]1cc(-c2ccccc2)n2c1CCC2.[Cl-] |
| InChI | InChI=1S/C14H14N3.ClH/c15-8-10-16-11-13(12-5-2-1-3-6-12)17-9-4-7-14(16)17;/h1-3,5-6,11H,4,7,9-10H2;1H/q+1;/p-1 |
| InChIKey | RSAOLXFCTAANBD-UHFFFAOYSA-M |
| XLogP | -1.08 |
| TPSA | 32.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|