C21H20BrN3 — CID 102552724
2-(3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl)benzonitrile bromide (PubChem CID 102552724) has the molecular formula C21H20BrN3 and a molecular weight of 394.32 g/mol. Its IUPAC name is 2-(3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl)benzonitrile bromide.
| Compound Name | 2-(3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl)benzonitrile bromide |
|---|---|
| PubChem CID | 102552724 |
| Molecular Formula | C21H20BrN3 |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 2-(3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl)benzonitrile bromide |
| SMILES | N#Cc1ccccc1-[n+]1cc(-c2ccccc2)n2c1CCCCC2.[Br-] |
| InChI | InChI=1S/C21H20N3.BrH/c22-15-18-11-6-7-12-19(18)24-16-20(17-9-3-1-4-10-17)23-14-8-2-5-13-21(23)24;/h1,3-4,6-7,9-12,16H,2,5,8,13-14H2;1H/q+1;/p-1 |
| InChIKey | VNQLDJGNUSDVTD-UHFFFAOYSA-M |
| XLogP | 1.03 |
| TPSA | 32.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|