C23H25N2O2+ — CID 24998206
methyl 4-[(3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl)methyl]benzoate (PubChem CID 24998206) has the molecular formula C23H25N2O2+ and a molecular weight of 361.47 g/mol. Its IUPAC name is methyl 4-[(3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl)methyl]benzoate.
| Compound Name | methyl 4-[(3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 24998206 |
| Molecular Formula | C23H25N2O2+ |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | methyl 4-[(3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(C[n+]2cc(-c3ccccc3)n3c2CCCCC3)cc1 |
| InChI | InChI=1S/C23H25N2O2/c1-27-23(26)20-13-11-18(12-14-20)16-24-17-21(19-8-4-2-5-9-19)25-15-7-3-6-10-22(24)25/h2,4-5,8-9,11-14,17H,3,6-7,10,15-16H2,1H3/q+1 |
| InChIKey | YDSFHVGQUZIAOL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|