C20H20ClFN2 — CID 44662530
1-[(4-fluorophenyl)methyl]-3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride (PubChem CID 44662530) has the molecular formula C20H20ClFN2 and a molecular weight of 342.85 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride |
|---|---|
| PubChem CID | 44662530 |
| Molecular Formula | C20H20ClFN2 |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride |
| SMILES | Cc1ccc(-c2c[n+](Cc3ccc(F)cc3)c3n2CCC3)cc1.[Cl-] |
| InChI | InChI=1S/C20H20FN2.ClH/c1-15-4-8-17(9-5-15)19-14-22(20-3-2-12-23(19)20)13-16-6-10-18(21)11-7-16;/h4-11,14H,2-3,12-13H2,1H3;1H/q+1;/p-1 |
| InChIKey | ICMPNSQDIRUVRX-UHFFFAOYSA-M |
| XLogP | 0.89 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|