C22H22BrFN2O — CID 44662656
1-(4-ethylphenyl)-2-[3-(4-fluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanone bromide (PubChem CID 44662656) has the molecular formula C22H22BrFN2O and a molecular weight of 429.33 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-2-[3-(4-fluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanone bromide.
| Compound Name | 1-(4-ethylphenyl)-2-[3-(4-fluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanone bromide |
|---|---|
| PubChem CID | 44662656 |
| Molecular Formula | C22H22BrFN2O |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 1-(4-ethylphenyl)-2-[3-(4-fluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanone bromide |
| SMILES | CCc1ccc(C(=O)C[n+]2cc(-c3ccc(F)cc3)n3c2CCC3)cc1.[Br-] |
| InChI | InChI=1S/C22H22FN2O.BrH/c1-2-16-5-7-18(8-6-16)21(26)15-24-14-20(25-13-3-4-22(24)25)17-9-11-19(23)12-10-17;/h5-12,14H,2-4,13,15H2,1H3;1H/q+1;/p-1 |
| InChIKey | FXRDZOKUJPIARZ-UHFFFAOYSA-M |
| XLogP | 0.98 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|