C20H16Cl3N2O+ — CID 1398854
1-(4-chlorophenyl)-2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanone (PubChem CID 1398854) has the molecular formula C20H16Cl3N2O+ and a molecular weight of 406.72 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanone.
| Compound Name | 1-(4-chlorophenyl)-2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 1398854 |
| Molecular Formula | C20H16Cl3N2O+ |
| Molecular Weight | 406.72 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanone |
| SMILES | O=C(C[n+]1cc(-c2ccc(Cl)c(Cl)c2)n2c1CCC2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H16Cl3N2O/c21-15-6-3-13(4-7-15)19(26)12-24-11-18(25-9-1-2-20(24)25)14-5-8-16(22)17(23)10-14/h3-8,10-11H,1-2,9,12H2/q+1 |
| InChIKey | WBOVVJSQGQXPGP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.72 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|