C21H20BrClN2O2 — CID 44661714
2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-1-(3-methoxyphenyl)ethanone bromide (PubChem CID 44661714) has the molecular formula C21H20BrClN2O2 and a molecular weight of 447.76 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-1-(3-methoxyphenyl)ethanone bromide.
| Compound Name | 2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-1-(3-methoxyphenyl)ethanone bromide |
|---|---|
| PubChem CID | 44661714 |
| Molecular Formula | C21H20BrClN2O2 |
| Molecular Weight | 447.76 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-1-(3-methoxyphenyl)ethanone bromide |
| SMILES | COc1cccc(C(=O)C[n+]2cc(-c3ccc(Cl)cc3)n3c2CCC3)c1.[Br-] |
| InChI | InChI=1S/C21H20ClN2O2.BrH/c1-26-18-5-2-4-16(12-18)20(25)14-23-13-19(24-11-3-6-21(23)24)15-7-9-17(22)10-8-15;/h2,4-5,7-10,12-13H,3,6,11,14H2,1H3;1H/q+1;/p-1 |
| InChIKey | IARSCWSNVNVLAJ-UHFFFAOYSA-M |
| XLogP | 0.94 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.76 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|