C24H27N2O2+ — CID 2326863
2-[3-(4-methoxyphenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]-1-(4-methylphenyl)ethanone (PubChem CID 2326863) has the molecular formula C24H27N2O2+ and a molecular weight of 375.49 g/mol. Its IUPAC name is 2-[3-(4-methoxyphenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]-1-(4-methylphenyl)ethanone.
| Compound Name | 2-[3-(4-methoxyphenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]-1-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 2326863 |
| Molecular Formula | C24H27N2O2+ |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 2-[3-(4-methoxyphenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]-1-(4-methylphenyl)ethanone |
| SMILES | COc1ccc(-c2c[n+](CC(=O)c3ccc(C)cc3)c3n2CCCCC3)cc1 |
| InChI | InChI=1S/C24H27N2O2/c1-18-7-9-20(10-8-18)23(27)17-25-16-22(19-11-13-21(28-2)14-12-19)26-15-5-3-4-6-24(25)26/h7-14,16H,3-6,15,17H2,1-2H3/q+1 |
| InChIKey | DXZLNNSNPWOVTB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|