C22H22N3O4+ — CID 6617637
2-[3-(4-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-1-ium-1-yl]-1-(3-nitrophenyl)ethanone (PubChem CID 6617637) has the molecular formula C22H22N3O4+ and a molecular weight of 392.44 g/mol. Its IUPAC name is 2-[3-(4-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-1-ium-1-yl]-1-(3-nitrophenyl)ethanone.
| Compound Name | 2-[3-(4-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-1-ium-1-yl]-1-(3-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 6617637 |
| Molecular Formula | C22H22N3O4+ |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-[3-(4-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-1-ium-1-yl]-1-(3-nitrophenyl)ethanone |
| SMILES | COc1ccc(-c2c[n+](CC(=O)c3cccc([N+](=O)[O-])c3)c3n2CCCC3)cc1 |
| InChI | InChI=1S/C22H22N3O4/c1-29-19-10-8-16(9-11-19)20-14-23(22-7-2-3-12-24(20)22)15-21(26)17-5-4-6-18(13-17)25(27)28/h4-6,8-11,13-14H,2-3,7,12,15H2,1H3/q+1 |
| InChIKey | WFRPXUBJKIBSFC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 78.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|