C20H21N4O3+ — CID 5161191
2-[2-amino-4-(3,4-dimethylphenyl)-3-methylimidazol-1-ium-1-yl]-1-(3-nitrophenyl)ethanone (PubChem CID 5161191) has the molecular formula C20H21N4O3+ and a molecular weight of 365.41 g/mol. Its IUPAC name is 2-[2-amino-4-(3,4-dimethylphenyl)-3-methylimidazol-1-ium-1-yl]-1-(3-nitrophenyl)ethanone.
| Compound Name | 2-[2-amino-4-(3,4-dimethylphenyl)-3-methylimidazol-1-ium-1-yl]-1-(3-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 5161191 |
| Molecular Formula | C20H21N4O3+ |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 2-[2-amino-4-(3,4-dimethylphenyl)-3-methylimidazol-1-ium-1-yl]-1-(3-nitrophenyl)ethanone |
| SMILES | Cc1ccc(-c2c[n+](CC(=O)c3cccc([N+](=O)[O-])c3)c(N)n2C)cc1C |
| InChI | InChI=1S/C20H20N4O3/c1-13-7-8-15(9-14(13)2)18-11-23(20(21)22(18)3)12-19(25)16-5-4-6-17(10-16)24(26)27/h4-11,21H,12H2,1-3H3/p+1 |
| InChIKey | LBLRRBSUFWNDOT-UHFFFAOYSA-O |
| XLogP | 2.97 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|