C19H20N3O2+ — CID 5098935
2-[2-amino-4-(3-methoxyphenyl)-3-methylimidazol-1-ium-1-yl]-1-phenylethanone (PubChem CID 5098935) has the molecular formula C19H20N3O2+ and a molecular weight of 322.39 g/mol. Its IUPAC name is 2-[2-amino-4-(3-methoxyphenyl)-3-methylimidazol-1-ium-1-yl]-1-phenylethanone.
| Compound Name | 2-[2-amino-4-(3-methoxyphenyl)-3-methylimidazol-1-ium-1-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 5098935 |
| Molecular Formula | C19H20N3O2+ |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 2-[2-amino-4-(3-methoxyphenyl)-3-methylimidazol-1-ium-1-yl]-1-phenylethanone |
| SMILES | COc1cccc(-c2c[n+](CC(=O)c3ccccc3)c(N)n2C)c1 |
| InChI | InChI=1S/C19H19N3O2/c1-21-17(15-9-6-10-16(11-15)24-2)12-22(19(21)20)13-18(23)14-7-4-3-5-8-14/h3-12,20H,13H2,1-2H3/p+1 |
| InChIKey | VGIAVOOAQUHICE-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 61.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|