C15H15BrN2O3S — CID 11639550
1-(3-nitrophenyl)-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-3-yl)ethanone bromide (PubChem CID 11639550) has the molecular formula C15H15BrN2O3S and a molecular weight of 383.27 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-3-yl)ethanone bromide.
| Compound Name | 1-(3-nitrophenyl)-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-3-yl)ethanone bromide |
|---|---|
| PubChem CID | 11639550 |
| Molecular Formula | C15H15BrN2O3S |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 1-(3-nitrophenyl)-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-3-yl)ethanone bromide |
| SMILES | O=C(C[n+]1csc2c1CCCC2)c1cccc([N+](=O)[O-])c1.[Br-] |
| InChI | InChI=1S/C15H15N2O3S.BrH/c18-14(11-4-3-5-12(8-11)17(19)20)9-16-10-21-15-7-2-1-6-13(15)16;/h3-5,8,10H,1-2,6-7,9H2;1H/q+1;/p-1 |
| InChIKey | CIVVJSSLPUMEAS-UHFFFAOYSA-M |
| XLogP | -0.29 |
| TPSA | 64.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|