C14H15BrN4O3S — CID 135409997
N,N-dimethyl-N'-[3-[2-(3-nitrophenyl)-2-oxoethyl]-1,3-thiazol-3-ium-2-yl]methanimidamide bromide (PubChem CID 135409997) has the molecular formula C14H15BrN4O3S and a molecular weight of 399.27 g/mol. Its IUPAC name is N,N-dimethyl-N'-[3-[2-(3-nitrophenyl)-2-oxoethyl]-1,3-thiazol-3-ium-2-yl]methanimidamide bromide.
| Compound Name | N,N-dimethyl-N'-[3-[2-(3-nitrophenyl)-2-oxoethyl]-1,3-thiazol-3-ium-2-yl]methanimidamide bromide |
|---|---|
| PubChem CID | 135409997 |
| Molecular Formula | C14H15BrN4O3S |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | N,N-dimethyl-N'-[3-[2-(3-nitrophenyl)-2-oxoethyl]-1,3-thiazol-3-ium-2-yl]methanimidamide bromide |
| SMILES | CN(C)/C=N/c1scc[n+]1CC(=O)c1cccc([N+](=O)[O-])c1.[Br-] |
| InChI | InChI=1S/C14H15N4O3S.BrH/c1-16(2)10-15-14-17(6-7-22-14)9-13(19)11-4-3-5-12(8-11)18(20)21;/h3-8,10H,9H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | LEHATRNHVLQSJH-UHFFFAOYSA-M |
| XLogP | -0.95 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|