C14H16BrN5O3S — CID 135409995
N,N-dimethyl-N'-[5-methyl-3-[2-(3-nitrophenyl)-2-oxoethyl]-1,3,4-thiadiazol-3-ium-2-yl]methanimidamide bromide (PubChem CID 135409995) has the molecular formula C14H16BrN5O3S and a molecular weight of 414.29 g/mol. Its IUPAC name is N,N-dimethyl-N'-[5-methyl-3-[2-(3-nitrophenyl)-2-oxoethyl]-1,3,4-thiadiazol-3-ium-2-yl]methanimidamide bromide.
| Compound Name | N,N-dimethyl-N'-[5-methyl-3-[2-(3-nitrophenyl)-2-oxoethyl]-1,3,4-thiadiazol-3-ium-2-yl]methanimidamide bromide |
|---|---|
| PubChem CID | 135409995 |
| Molecular Formula | C14H16BrN5O3S |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | N,N-dimethyl-N'-[5-methyl-3-[2-(3-nitrophenyl)-2-oxoethyl]-1,3,4-thiadiazol-3-ium-2-yl]methanimidamide bromide |
| SMILES | Cc1n[n+](CC(=O)c2cccc([N+](=O)[O-])c2)c(/N=C/N(C)C)s1.[Br-] |
| InChI | InChI=1S/C14H16N5O3S.BrH/c1-10-16-18(14(23-10)15-9-17(2)3)8-13(20)11-5-4-6-12(7-11)19(21)22;/h4-7,9H,8H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | IHHJLOXCUVYHSE-UHFFFAOYSA-M |
| XLogP | -1.24 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|