C21H22BrN3O3 — CID 163409462
1-(2-methoxyphenyl)-3-(4-nitrophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium bromide (PubChem CID 163409462) has the molecular formula C21H22BrN3O3 and a molecular weight of 444.33 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-(4-nitrophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium bromide.
| Compound Name | 1-(2-methoxyphenyl)-3-(4-nitrophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium bromide |
|---|---|
| PubChem CID | 163409462 |
| Molecular Formula | C21H22BrN3O3 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-(4-nitrophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium bromide |
| SMILES | COc1ccccc1-[n+]1cc(-c2ccc([N+](=O)[O-])cc2)n2c1CCCCC2.[Br-] |
| InChI | InChI=1S/C21H22N3O3.BrH/c1-27-20-8-5-4-7-18(20)23-15-19(22-14-6-2-3-9-21(22)23)16-10-12-17(13-11-16)24(25)26;/h4-5,7-8,10-13,15H,2-3,6,9,14H2,1H3;1H/q+1;/p-1 |
| InChIKey | HDCCYXMQKULPTQ-UHFFFAOYSA-M |
| XLogP | 1.08 |
| TPSA | 61.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|