C14H12N2O3 — CID 42612277
3-(4-nitrophenyl)-6,7-dihydro-5H-indolizin-8-one (PubChem CID 42612277) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-6,7-dihydro-5H-indolizin-8-one.
| Compound Name | 3-(4-nitrophenyl)-6,7-dihydro-5H-indolizin-8-one |
|---|---|
| PubChem CID | 42612277 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 3-(4-nitrophenyl)-6,7-dihydro-5H-indolizin-8-one |
| SMILES | O=C1CCCn2c1ccc2-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H12N2O3/c17-14-2-1-9-15-12(7-8-13(14)15)10-3-5-11(6-4-10)16(18)19/h3-8H,1-2,9H2 |
| InChIKey | HYCLGUARVLEHDF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 65.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|