C18H14N2O3 — CID 58168686
2-(4-nitrophenyl)-4-azatricyclo[6.4.1.04,13]trideca-1(13),2,5,7-tetraen-9-one (PubChem CID 58168686) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-4-azatricyclo[6.4.1.04,13]trideca-1(13),2,5,7-tetraen-9-one.
| Compound Name | 2-(4-nitrophenyl)-4-azatricyclo[6.4.1.04,13]trideca-1(13),2,5,7-tetraen-9-one |
|---|---|
| PubChem CID | 58168686 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-(4-nitrophenyl)-4-azatricyclo[6.4.1.04,13]trideca-1(13),2,5,7-tetraen-9-one |
| SMILES | O=C1CCCc2c(-c3ccc([N+](=O)[O-])cc3)cn3cccc1c23 |
| InChI | InChI=1S/C18H14N2O3/c21-17-5-1-3-14-16(11-19-10-2-4-15(17)18(14)19)12-6-8-13(9-7-12)20(22)23/h2,4,6-11H,1,3,5H2 |
| InChIKey | ZGENMSOPISMKIP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 64.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|