C20H21NO2 — CID 15325074
9-(4-nitrophenyl)-1,2,3,4,5,6,7,8-octahydrophenanthrene (PubChem CID 15325074) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 9-(4-nitrophenyl)-1,2,3,4,5,6,7,8-octahydrophenanthrene.
| Compound Name | 9-(4-nitrophenyl)-1,2,3,4,5,6,7,8-octahydrophenanthrene |
|---|---|
| PubChem CID | 15325074 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 9-(4-nitrophenyl)-1,2,3,4,5,6,7,8-octahydrophenanthrene |
| SMILES | O=[N+]([O-])c1ccc(-c2cc3c(c4c2CCCC4)CCCC3)cc1 |
| InChI | InChI=1S/C20H21NO2/c22-21(23)16-11-9-14(10-12-16)20-13-15-5-1-2-6-17(15)18-7-3-4-8-19(18)20/h9-13H,1-8H2 |
| InChIKey | DPSBYWJWUXUVOT-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|