C15H15N2O3S+ — CID 7731141
4-methylsulfanyl-2-(4-nitrophenyl)-5,6,7,8-tetrahydro-1,3-benzoxazin-1-ium (PubChem CID 7731141) has the molecular formula C15H15N2O3S+ and a molecular weight of 303.36 g/mol. Its IUPAC name is 4-methylsulfanyl-2-(4-nitrophenyl)-5,6,7,8-tetrahydro-1,3-benzoxazin-1-ium.
| Compound Name | 4-methylsulfanyl-2-(4-nitrophenyl)-5,6,7,8-tetrahydro-1,3-benzoxazin-1-ium |
|---|---|
| PubChem CID | 7731141 |
| Molecular Formula | C15H15N2O3S+ |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 4-methylsulfanyl-2-(4-nitrophenyl)-5,6,7,8-tetrahydro-1,3-benzoxazin-1-ium |
| SMILES | CSc1nc(-c2ccc([N+](=O)[O-])cc2)[o+]c2c1CCCC2 |
| InChI | InChI=1S/C15H15N2O3S/c1-21-15-12-4-2-3-5-13(12)20-14(16-15)10-6-8-11(9-7-10)17(18)19/h6-9H,2-5H2,1H3/q+1 |
| InChIKey | JOSNICJXBJXRIL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 67.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|