C13H8N4O4 — CID 23316954
3-nitro-8-(4-nitrophenyl)imidazo[1,2-a]pyridine (PubChem CID 23316954) has the molecular formula C13H8N4O4 and a molecular weight of 284.23 g/mol. Its IUPAC name is 3-nitro-8-(4-nitrophenyl)imidazo[1,2-a]pyridine.
| Compound Name | 3-nitro-8-(4-nitrophenyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 23316954 |
| Molecular Formula | C13H8N4O4 |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 3-nitro-8-(4-nitrophenyl)imidazo[1,2-a]pyridine |
| SMILES | O=[N+]([O-])c1ccc(-c2cccn3c([N+](=O)[O-])cnc23)cc1 |
| InChI | InChI=1S/C13H8N4O4/c18-16(19)10-5-3-9(4-6-10)11-2-1-7-15-12(17(20)21)8-14-13(11)15/h1-8H |
| InChIKey | XNYNOICPAYZQPW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|