C12H9N5O2 — CID 131865111
6-(4-nitrophenyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 131865111) has the molecular formula C12H9N5O2 and a molecular weight of 255.24 g/mol. Its IUPAC name is 6-(4-nitrophenyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 6-(4-nitrophenyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 131865111 |
| Molecular Formula | C12H9N5O2 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 6-(4-nitrophenyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Nc1c(-c2ccc([N+](=O)[O-])cc2)cnc2ccnn12 |
| InChI | InChI=1S/C12H9N5O2/c13-12-10(7-14-11-5-6-15-16(11)12)8-1-3-9(4-2-8)17(18)19/h1-7H,13H2 |
| InChIKey | VOZLKZBEABNUDE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|