C12H10N6O2 — CID 133439849
5-nitro-N-(pyrazolo[1,5-a]pyrimidin-7-ylmethyl)pyridin-2-amine (PubChem CID 133439849) has the molecular formula C12H10N6O2 and a molecular weight of 270.25 g/mol. Its IUPAC name is 5-nitro-N-(pyrazolo[1,5-a]pyrimidin-7-ylmethyl)pyridin-2-amine.
| Compound Name | 5-nitro-N-(pyrazolo[1,5-a]pyrimidin-7-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 133439849 |
| Molecular Formula | C12H10N6O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 5-nitro-N-(pyrazolo[1,5-a]pyrimidin-7-ylmethyl)pyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(NCc2ccnc3ccnn23)nc1 |
| InChI | InChI=1S/C12H10N6O2/c19-18(20)10-1-2-11(15-8-10)14-7-9-3-5-13-12-4-6-16-17(9)12/h1-6,8H,7H2,(H,14,15) |
| InChIKey | CFWMYAQQSUEARL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|