C13H10N6O3 — CID 133275091
5-nitro-N-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-amine (PubChem CID 133275091) has the molecular formula C13H10N6O3 and a molecular weight of 298.26 g/mol. Its IUPAC name is 5-nitro-N-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-amine.
| Compound Name | 5-nitro-N-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 133275091 |
| Molecular Formula | C13H10N6O3 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 5-nitro-N-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(NCc2nc(-c3ccncc3)no2)nc1 |
| InChI | InChI=1S/C13H10N6O3/c20-19(21)10-1-2-11(15-7-10)16-8-12-17-13(18-22-12)9-3-5-14-6-4-9/h1-7H,8H2,(H,15,16) |
| InChIKey | AGJFTKNJFILSLN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 119.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|