C15H12ClN5O3 — CID 133295463
N-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-5-nitropyridin-2-amine (PubChem CID 133295463) has the molecular formula C15H12ClN5O3 and a molecular weight of 345.75 g/mol. Its IUPAC name is N-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-5-nitropyridin-2-amine.
| Compound Name | N-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 133295463 |
| Molecular Formula | C15H12ClN5O3 |
| Molecular Weight | 345.75 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-5-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(NCCc2nc(-c3ccc(Cl)cc3)no2)nc1 |
| InChI | InChI=1S/C15H12ClN5O3/c16-11-3-1-10(2-4-11)15-19-14(24-20-15)7-8-17-13-6-5-12(9-18-13)21(22)23/h1-6,9H,7-8H2,(H,17,18) |
| InChIKey | OKEWPLYYNXYYKG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.75 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|