C10H10N6O2 — CID 133367182
2-[[(5-nitro-2-pyridinyl)amino]methyl]pyrimidin-4-amine (PubChem CID 133367182) has the molecular formula C10H10N6O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is 2-[[(5-nitro-2-pyridinyl)amino]methyl]pyrimidin-4-amine.
| Compound Name | 2-[[(5-nitro-2-pyridinyl)amino]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133367182 |
| Molecular Formula | C10H10N6O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-[[(5-nitro-2-pyridinyl)amino]methyl]pyrimidin-4-amine |
| SMILES | Nc1ccnc(CNc2ccc([N+](=O)[O-])cn2)n1 |
| InChI | InChI=1S/C10H10N6O2/c11-8-3-4-12-10(15-8)6-14-9-2-1-7(5-13-9)16(17)18/h1-5H,6H2,(H,13,14)(H2,11,12,15) |
| InChIKey | APAGGPQYDRFVCM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|