C11H7N5O3 — CID 135789665
8-(4-nitrophenyl)-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one (PubChem CID 135789665) has the molecular formula C11H7N5O3 and a molecular weight of 257.21 g/mol. Its IUPAC name is 8-(4-nitrophenyl)-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one.
| Compound Name | 8-(4-nitrophenyl)-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 135789665 |
| Molecular Formula | C11H7N5O3 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 8-(4-nitrophenyl)-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one |
| SMILES | O=c1[nH]cnc2c(-c3ccc([N+](=O)[O-])cc3)cnn12 |
| InChI | InChI=1S/C11H7N5O3/c17-11-13-6-12-10-9(5-14-15(10)11)7-1-3-8(4-2-7)16(18)19/h1-6H,(H,12,13,17) |
| InChIKey | RXTJYPGMMINKBA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|