C12H7N7O3 — CID 136854448
8-(4-nitrophenyl)-1,4-dihydro-[1,2,4]triazolo[5,1-f]purin-5-one (PubChem CID 136854448) has the molecular formula C12H7N7O3 and a molecular weight of 297.23 g/mol. Its IUPAC name is 8-(4-nitrophenyl)-1,4-dihydro-[1,2,4]triazolo[5,1-f]purin-5-one.
| Compound Name | 8-(4-nitrophenyl)-1,4-dihydro-[1,2,4]triazolo[5,1-f]purin-5-one |
|---|---|
| PubChem CID | 136854448 |
| Molecular Formula | C12H7N7O3 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 8-(4-nitrophenyl)-1,4-dihydro-[1,2,4]triazolo[5,1-f]purin-5-one |
| SMILES | O=c1[nH]c2nc[nH]c2c2nc(-c3ccc([N+](=O)[O-])cc3)nn12 |
| InChI | InChI=1S/C12H7N7O3/c20-12-16-10-8(13-5-14-10)11-15-9(17-18(11)12)6-1-3-7(4-2-6)19(21)22/h1-5H,(H,13,14)(H,16,20) |
| InChIKey | HYHUMTCYSAQJJR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|