C20H16N6O5 — CID 18573982
9-(4-ethoxyphenyl)-2-(4-nitrophenyl)-8-oxo-7H-purine-6-carboxamide (PubChem CID 18573982) has the molecular formula C20H16N6O5 and a molecular weight of 420.39 g/mol. Its IUPAC name is 9-(4-ethoxyphenyl)-2-(4-nitrophenyl)-8-oxo-7H-purine-6-carboxamide.
| Compound Name | 9-(4-ethoxyphenyl)-2-(4-nitrophenyl)-8-oxo-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 18573982 |
| Molecular Formula | C20H16N6O5 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 9-(4-ethoxyphenyl)-2-(4-nitrophenyl)-8-oxo-7H-purine-6-carboxamide |
| SMILES | CCOc1ccc(-n2c(=O)[nH]c3c(C(N)=O)nc(-c4ccc([N+](=O)[O-])cc4)nc32)cc1 |
| InChI | InChI=1S/C20H16N6O5/c1-2-31-14-9-7-12(8-10-14)25-19-16(23-20(25)28)15(17(21)27)22-18(24-19)11-3-5-13(6-4-11)26(29)30/h3-10H,2H2,1H3,(H2,21,27)(H,23,28) |
| InChIKey | CYCZNPCTPPRPMQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 159.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|