C27H21N5O4 — CID 130340366
ethyl 3-[6-carbamoyl-8-oxo-2-(4-phenylphenyl)-7H-purin-9-yl]benzoate (PubChem CID 130340366) has the molecular formula C27H21N5O4 and a molecular weight of 479.50 g/mol. Its IUPAC name is ethyl 3-[6-carbamoyl-8-oxo-2-(4-phenylphenyl)-7H-purin-9-yl]benzoate.
| Compound Name | ethyl 3-[6-carbamoyl-8-oxo-2-(4-phenylphenyl)-7H-purin-9-yl]benzoate |
|---|---|
| PubChem CID | 130340366 |
| Molecular Formula | C27H21N5O4 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | ethyl 3-[6-carbamoyl-8-oxo-2-(4-phenylphenyl)-7H-purin-9-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-n2c(=O)[nH]c3c(C(N)=O)nc(-c4ccc(-c5ccccc5)cc4)nc32)c1 |
| InChI | InChI=1S/C27H21N5O4/c1-2-36-26(34)19-9-6-10-20(15-19)32-25-22(30-27(32)35)21(23(28)33)29-24(31-25)18-13-11-17(12-14-18)16-7-4-3-5-8-16/h3-15H,2H2,1H3,(H2,28,33)(H,30,35) |
| InChIKey | OVTDKXNYSHQPCO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |