C25H25N5O5 — CID 130340031
butyl 3-[6-carbamoyl-2-(4-ethoxyphenyl)-8-oxo-7H-purin-9-yl]benzoate (PubChem CID 130340031) has the molecular formula C25H25N5O5 and a molecular weight of 475.51 g/mol. Its IUPAC name is butyl 3-[6-carbamoyl-2-(4-ethoxyphenyl)-8-oxo-7H-purin-9-yl]benzoate.
| Compound Name | butyl 3-[6-carbamoyl-2-(4-ethoxyphenyl)-8-oxo-7H-purin-9-yl]benzoate |
|---|---|
| PubChem CID | 130340031 |
| Molecular Formula | C25H25N5O5 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | butyl 3-[6-carbamoyl-2-(4-ethoxyphenyl)-8-oxo-7H-purin-9-yl]benzoate |
| SMILES | CCCCOC(=O)c1cccc(-n2c(=O)[nH]c3c(C(N)=O)nc(-c4ccc(OCC)cc4)nc32)c1 |
| InChI | InChI=1S/C25H25N5O5/c1-3-5-13-35-24(32)16-7-6-8-17(14-16)30-23-20(28-25(30)33)19(21(26)31)27-22(29-23)15-9-11-18(12-10-15)34-4-2/h6-12,14H,3-5,13H2,1-2H3,(H2,26,31)(H,28,33) |
| InChIKey | OJTOGSHUBJKZGC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|