C22H20FN5O3 — CID 22577547
2-(4-butoxyphenyl)-9-(4-fluorophenyl)-8-oxo-7H-purine-6-carboxamide (PubChem CID 22577547) has the molecular formula C22H20FN5O3 and a molecular weight of 421.43 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-9-(4-fluorophenyl)-8-oxo-7H-purine-6-carboxamide.
| Compound Name | 2-(4-butoxyphenyl)-9-(4-fluorophenyl)-8-oxo-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 22577547 |
| Molecular Formula | C22H20FN5O3 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-(4-butoxyphenyl)-9-(4-fluorophenyl)-8-oxo-7H-purine-6-carboxamide |
| SMILES | CCCCOc1ccc(-c2nc(C(N)=O)c3[nH]c(=O)n(-c4ccc(F)cc4)c3n2)cc1 |
| InChI | InChI=1S/C22H20FN5O3/c1-2-3-12-31-16-10-4-13(5-11-16)20-25-17(19(24)29)18-21(27-20)28(22(30)26-18)15-8-6-14(23)7-9-15/h4-11H,2-3,12H2,1H3,(H2,24,29)(H,26,30) |
| InChIKey | JOUYJOFZMOGWCD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|