C20H17N5O4 — CID 130340242
2-(4-ethoxyphenyl)-N-hydroxy-8-oxo-9-phenyl-7H-purine-6-carboxamide (PubChem CID 130340242) has the molecular formula C20H17N5O4 and a molecular weight of 391.39 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N-hydroxy-8-oxo-9-phenyl-7H-purine-6-carboxamide.
| Compound Name | 2-(4-ethoxyphenyl)-N-hydroxy-8-oxo-9-phenyl-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 130340242 |
| Molecular Formula | C20H17N5O4 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-hydroxy-8-oxo-9-phenyl-7H-purine-6-carboxamide |
| SMILES | CCOc1ccc(-c2nc(C(=O)NO)c3[nH]c(=O)n(-c4ccccc4)c3n2)cc1 |
| InChI | InChI=1S/C20H17N5O4/c1-2-29-14-10-8-12(9-11-14)17-21-16(19(26)24-28)15-18(23-17)25(20(27)22-15)13-6-4-3-5-7-13/h3-11,28H,2H2,1H3,(H,22,27)(H,24,26) |
| InChIKey | FUSBUAVUZCABMM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|