C20H17N5O4 — CID 23603281
2-(3,4-dimethoxyphenyl)-8-oxo-9-phenyl-7H-purine-6-carboxamide (PubChem CID 23603281) has the molecular formula C20H17N5O4 and a molecular weight of 391.39 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-8-oxo-9-phenyl-7H-purine-6-carboxamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-8-oxo-9-phenyl-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 23603281 |
| Molecular Formula | C20H17N5O4 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-8-oxo-9-phenyl-7H-purine-6-carboxamide |
| SMILES | COc1ccc(-c2nc(C(N)=O)c3[nH]c(=O)n(-c4ccccc4)c3n2)cc1OC |
| InChI | InChI=1S/C20H17N5O4/c1-28-13-9-8-11(10-14(13)29-2)18-22-15(17(21)26)16-19(24-18)25(20(27)23-16)12-6-4-3-5-7-12/h3-10H,1-2H3,(H2,21,26)(H,23,27) |
| InChIKey | DVWGSKKHYIZCAM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |