C18H13N5O3 — CID 16825178
2-(3-hydroxyphenyl)-8-oxo-9-phenyl-7H-purine-6-carboxamide (PubChem CID 16825178) has the molecular formula C18H13N5O3 and a molecular weight of 347.33 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-8-oxo-9-phenyl-7H-purine-6-carboxamide.
| Compound Name | 2-(3-hydroxyphenyl)-8-oxo-9-phenyl-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 16825178 |
| Molecular Formula | C18H13N5O3 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-(3-hydroxyphenyl)-8-oxo-9-phenyl-7H-purine-6-carboxamide |
| SMILES | NC(=O)c1nc(-c2cccc(O)c2)nc2c1[nH]c(=O)n2-c1ccccc1 |
| InChI | InChI=1S/C18H13N5O3/c19-15(25)13-14-17(22-16(20-13)10-5-4-8-12(24)9-10)23(18(26)21-14)11-6-2-1-3-7-11/h1-9,24H,(H2,19,25)(H,21,26) |
| InChIKey | JFESRFZJVBQIAZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |