C18H11Cl2N5O3 — CID 24936459
9-(2,3-dichlorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purine-6-carboxamide (PubChem CID 24936459) has the molecular formula C18H11Cl2N5O3 and a molecular weight of 416.22 g/mol. Its IUPAC name is 9-(2,3-dichlorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purine-6-carboxamide.
| Compound Name | 9-(2,3-dichlorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 24936459 |
| Molecular Formula | C18H11Cl2N5O3 |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 9-(2,3-dichlorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purine-6-carboxamide |
| SMILES | NC(=O)c1nc(-c2cccc(O)c2)nc2c1[nH]c(=O)n2-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H11Cl2N5O3/c19-10-5-2-6-11(12(10)20)25-17-14(23-18(25)28)13(15(21)27)22-16(24-17)8-3-1-4-9(26)7-8/h1-7,26H,(H2,21,27)(H,23,28) |
| InChIKey | WKVYFJGSNBRMLV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |