C17H10Cl2N6O2 — CID 7119031
9-(3,4-dichlorophenyl)-8-oxo-2-pyridin-4-yl-7H-purine-6-carboxamide (PubChem CID 7119031) has the molecular formula C17H10Cl2N6O2 and a molecular weight of 401.21 g/mol. Its IUPAC name is 9-(3,4-dichlorophenyl)-8-oxo-2-pyridin-4-yl-7H-purine-6-carboxamide.
| Compound Name | 9-(3,4-dichlorophenyl)-8-oxo-2-pyridin-4-yl-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 7119031 |
| Molecular Formula | C17H10Cl2N6O2 |
| Molecular Weight | 401.21 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | 9-(3,4-dichlorophenyl)-8-oxo-2-pyridin-4-yl-7H-purine-6-carboxamide |
| SMILES | NC(=O)c1nc(-c2ccncc2)nc2c1[nH]c(=O)n2-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H10Cl2N6O2/c18-10-2-1-9(7-11(10)19)25-16-13(23-17(25)27)12(14(20)26)22-15(24-16)8-3-5-21-6-4-8/h1-7H,(H2,20,26)(H,23,27) |
| InChIKey | BQYANXYWVALLLD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |