C18H14N6O2 — CID 20960079
9-(4-methylphenyl)-8-oxo-2-pyridin-3-yl-7H-purine-6-carboxamide (PubChem CID 20960079) has the molecular formula C18H14N6O2 and a molecular weight of 346.35 g/mol. Its IUPAC name is 9-(4-methylphenyl)-8-oxo-2-pyridin-3-yl-7H-purine-6-carboxamide.
| Compound Name | 9-(4-methylphenyl)-8-oxo-2-pyridin-3-yl-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 20960079 |
| Molecular Formula | C18H14N6O2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 9-(4-methylphenyl)-8-oxo-2-pyridin-3-yl-7H-purine-6-carboxamide |
| SMILES | Cc1ccc(-n2c(=O)[nH]c3c(C(N)=O)nc(-c4cccnc4)nc32)cc1 |
| InChI | InChI=1S/C18H14N6O2/c1-10-4-6-12(7-5-10)24-17-14(22-18(24)26)13(15(19)25)21-16(23-17)11-3-2-8-20-9-11/h2-9H,1H3,(H2,19,25)(H,22,26) |
| InChIKey | KBSKPQGQTIWNTQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |