C20H13F4N5O2 — CID 24821926
2-[3-fluoro-5-(trifluoromethyl)phenyl]-9-(4-methylphenyl)-8-oxo-7H-purine-6-carboxamide (PubChem CID 24821926) has the molecular formula C20H13F4N5O2 and a molecular weight of 431.35 g/mol. Its IUPAC name is 2-[3-fluoro-5-(trifluoromethyl)phenyl]-9-(4-methylphenyl)-8-oxo-7H-purine-6-carboxamide.
| Compound Name | 2-[3-fluoro-5-(trifluoromethyl)phenyl]-9-(4-methylphenyl)-8-oxo-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 24821926 |
| Molecular Formula | C20H13F4N5O2 |
| Molecular Weight | 431.35 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 2-[3-fluoro-5-(trifluoromethyl)phenyl]-9-(4-methylphenyl)-8-oxo-7H-purine-6-carboxamide |
| SMILES | Cc1ccc(-n2c(=O)[nH]c3c(C(N)=O)nc(-c4cc(F)cc(C(F)(F)F)c4)nc32)cc1 |
| InChI | InChI=1S/C20H13F4N5O2/c1-9-2-4-13(5-3-9)29-18-15(27-19(29)31)14(16(25)30)26-17(28-18)10-6-11(20(22,23)24)8-12(21)7-10/h2-8H,1H3,(H2,25,30)(H,27,31) |
| InChIKey | DQOLWRVPNQRASS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |