C20H16BrN5O2 — CID 16810154
2-(3-bromophenyl)-9-(3,4-dimethylphenyl)-8-oxo-7H-purine-6-carboxamide (PubChem CID 16810154) has the molecular formula C20H16BrN5O2 and a molecular weight of 438.29 g/mol. Its IUPAC name is 2-(3-bromophenyl)-9-(3,4-dimethylphenyl)-8-oxo-7H-purine-6-carboxamide.
| Compound Name | 2-(3-bromophenyl)-9-(3,4-dimethylphenyl)-8-oxo-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 16810154 |
| Molecular Formula | C20H16BrN5O2 |
| Molecular Weight | 438.29 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 2-(3-bromophenyl)-9-(3,4-dimethylphenyl)-8-oxo-7H-purine-6-carboxamide |
| SMILES | Cc1ccc(-n2c(=O)[nH]c3c(C(N)=O)nc(-c4cccc(Br)c4)nc32)cc1C |
| InChI | InChI=1S/C20H16BrN5O2/c1-10-6-7-14(8-11(10)2)26-19-16(24-20(26)28)15(17(22)27)23-18(25-19)12-4-3-5-13(21)9-12/h3-9H,1-2H3,(H2,22,27)(H,24,28) |
| InChIKey | SXYOSPMSOVSMPD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |