C17H19N5O2 — CID 7599549
9-(3,4-dimethylphenyl)-8-oxo-2-propyl-7H-purine-6-carboxamide (PubChem CID 7599549) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 9-(3,4-dimethylphenyl)-8-oxo-2-propyl-7H-purine-6-carboxamide.
| Compound Name | 9-(3,4-dimethylphenyl)-8-oxo-2-propyl-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 7599549 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 9-(3,4-dimethylphenyl)-8-oxo-2-propyl-7H-purine-6-carboxamide |
| SMILES | CCCc1nc(C(N)=O)c2[nH]c(=O)n(-c3ccc(C)c(C)c3)c2n1 |
| InChI | InChI=1S/C17H19N5O2/c1-4-5-12-19-13(15(18)23)14-16(20-12)22(17(24)21-14)11-7-6-9(2)10(3)8-11/h6-8H,4-5H2,1-3H3,(H2,18,23)(H,21,24) |
| InChIKey | OAUKDRGUSOEKRL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |