C16H17N5O4 — CID 7599567
9-(2,3-dimethoxyphenyl)-2-ethyl-8-oxo-7H-purine-6-carboxamide (PubChem CID 7599567) has the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. Its IUPAC name is 9-(2,3-dimethoxyphenyl)-2-ethyl-8-oxo-7H-purine-6-carboxamide.
| Compound Name | 9-(2,3-dimethoxyphenyl)-2-ethyl-8-oxo-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 7599567 |
| Molecular Formula | C16H17N5O4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 9-(2,3-dimethoxyphenyl)-2-ethyl-8-oxo-7H-purine-6-carboxamide |
| SMILES | CCc1nc(C(N)=O)c2[nH]c(=O)n(-c3cccc(OC)c3OC)c2n1 |
| InChI | InChI=1S/C16H17N5O4/c1-4-10-18-11(14(17)22)12-15(19-10)21(16(23)20-12)8-6-5-7-9(24-2)13(8)25-3/h5-7H,4H2,1-3H3,(H2,17,22)(H,20,23) |
| InChIKey | PADKLIFTKMNZDG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |