C19H13ClFN5O3 — CID 20960096
2-(2-chloro-6-fluorophenyl)-9-(2-methoxyphenyl)-8-oxo-7H-purine-6-carboxamide (PubChem CID 20960096) has the molecular formula C19H13ClFN5O3 and a molecular weight of 413.80 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-9-(2-methoxyphenyl)-8-oxo-7H-purine-6-carboxamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-9-(2-methoxyphenyl)-8-oxo-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 20960096 |
| Molecular Formula | C19H13ClFN5O3 |
| Molecular Weight | 413.80 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-9-(2-methoxyphenyl)-8-oxo-7H-purine-6-carboxamide |
| SMILES | COc1ccccc1-n1c(=O)[nH]c2c(C(N)=O)nc(-c3c(F)cccc3Cl)nc21 |
| InChI | InChI=1S/C19H13ClFN5O3/c1-29-12-8-3-2-7-11(12)26-18-15(24-19(26)28)14(16(22)27)23-17(25-18)13-9(20)5-4-6-10(13)21/h2-8H,1H3,(H2,22,27)(H,24,28) |
| InChIKey | QJCULLKLIMHMER-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.80 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |