C20H18N6O5S — CID 174957217
[3-[6-carbamoyl-9-(2-methoxyphenyl)-8-oxo-7H-purin-2-yl]anilino]methanesulfinic acid (PubChem CID 174957217) has the molecular formula C20H18N6O5S and a molecular weight of 454.47 g/mol. Its IUPAC name is [3-[6-carbamoyl-9-(2-methoxyphenyl)-8-oxo-7H-purin-2-yl]anilino]methanesulfinic acid.
| Compound Name | [3-[6-carbamoyl-9-(2-methoxyphenyl)-8-oxo-7H-purin-2-yl]anilino]methanesulfinic acid |
|---|---|
| PubChem CID | 174957217 |
| Molecular Formula | C20H18N6O5S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | [3-[6-carbamoyl-9-(2-methoxyphenyl)-8-oxo-7H-purin-2-yl]anilino]methanesulfinic acid |
| SMILES | COc1ccccc1-n1c(=O)[nH]c2c(C(N)=O)nc(-c3cccc(NCS(=O)O)c3)nc21 |
| InChI | InChI=1S/C20H18N6O5S/c1-31-14-8-3-2-7-13(14)26-19-16(24-20(26)28)15(17(21)27)23-18(25-19)11-5-4-6-12(9-11)22-10-32(29)30/h2-9,22H,10H2,1H3,(H2,21,27)(H,24,28)(H,29,30) |
| InChIKey | PNRCMPUYUKAZSS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 165.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|