C20H16FN5O4 — CID 7599574
9-(2,3-dimethoxyphenyl)-2-(3-fluorophenyl)-8-oxo-7H-purine-6-carboxamide (PubChem CID 7599574) has the molecular formula C20H16FN5O4 and a molecular weight of 409.38 g/mol. Its IUPAC name is 9-(2,3-dimethoxyphenyl)-2-(3-fluorophenyl)-8-oxo-7H-purine-6-carboxamide.
| Compound Name | 9-(2,3-dimethoxyphenyl)-2-(3-fluorophenyl)-8-oxo-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 7599574 |
| Molecular Formula | C20H16FN5O4 |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 9-(2,3-dimethoxyphenyl)-2-(3-fluorophenyl)-8-oxo-7H-purine-6-carboxamide |
| SMILES | COc1cccc(-n2c(=O)[nH]c3c(C(N)=O)nc(-c4cccc(F)c4)nc32)c1OC |
| InChI | InChI=1S/C20H16FN5O4/c1-29-13-8-4-7-12(16(13)30-2)26-19-15(24-20(26)28)14(17(22)27)23-18(25-19)10-5-3-6-11(21)9-10/h3-9H,1-2H3,(H2,22,27)(H,24,28) |
| InChIKey | QUWHLDLJWYXIPI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |