C16H10FN5O2S — CID 7519811
2-(3-fluorophenyl)-8-oxo-9-thiophen-2-yl-7H-purine-6-carboxamide (PubChem CID 7519811) has the molecular formula C16H10FN5O2S and a molecular weight of 355.35 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-8-oxo-9-thiophen-2-yl-7H-purine-6-carboxamide.
| Compound Name | 2-(3-fluorophenyl)-8-oxo-9-thiophen-2-yl-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 7519811 |
| Molecular Formula | C16H10FN5O2S |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 2-(3-fluorophenyl)-8-oxo-9-thiophen-2-yl-7H-purine-6-carboxamide |
| SMILES | NC(=O)c1nc(-c2cccc(F)c2)nc2c1[nH]c(=O)n2-c1cccs1 |
| InChI | InChI=1S/C16H10FN5O2S/c17-9-4-1-3-8(7-9)14-19-11(13(18)23)12-15(21-14)22(16(24)20-12)10-5-2-6-25-10/h1-7H,(H2,18,23)(H,20,24) |
| InChIKey | BZXUPQJMMFNTBR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |