C16H9Cl2N5O2S — CID 7519853
2-(2,4-dichlorophenyl)-8-oxo-9-thiophen-2-yl-7H-purine-6-carboxamide (PubChem CID 7519853) has the molecular formula C16H9Cl2N5O2S and a molecular weight of 406.25 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-8-oxo-9-thiophen-2-yl-7H-purine-6-carboxamide.
| Compound Name | 2-(2,4-dichlorophenyl)-8-oxo-9-thiophen-2-yl-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 7519853 |
| Molecular Formula | C16H9Cl2N5O2S |
| Molecular Weight | 406.25 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-8-oxo-9-thiophen-2-yl-7H-purine-6-carboxamide |
| SMILES | NC(=O)c1nc(-c2ccc(Cl)cc2Cl)nc2c1[nH]c(=O)n2-c1cccs1 |
| InChI | InChI=1S/C16H9Cl2N5O2S/c17-7-3-4-8(9(18)6-7)14-20-11(13(19)24)12-15(22-14)23(16(25)21-12)10-2-1-5-26-10/h1-6H,(H2,19,24)(H,21,25) |
| InChIKey | JZQSBUPQMLVCLH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |