C20H16ClN5O4 — CID 135584504
9-(4-chlorophenyl)-2-(3-ethoxy-2-hydroxyphenyl)-8-oxo-7H-purine-6-carboxamide (PubChem CID 135584504) has the molecular formula C20H16ClN5O4 and a molecular weight of 425.83 g/mol. Its IUPAC name is 9-(4-chlorophenyl)-2-(3-ethoxy-2-hydroxyphenyl)-8-oxo-7H-purine-6-carboxamide.
| Compound Name | 9-(4-chlorophenyl)-2-(3-ethoxy-2-hydroxyphenyl)-8-oxo-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 135584504 |
| Molecular Formula | C20H16ClN5O4 |
| Molecular Weight | 425.83 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 9-(4-chlorophenyl)-2-(3-ethoxy-2-hydroxyphenyl)-8-oxo-7H-purine-6-carboxamide |
| SMILES | CCOc1cccc(-c2nc(C(N)=O)c3[nH]c(=O)n(-c4ccc(Cl)cc4)c3n2)c1O |
| InChI | InChI=1S/C20H16ClN5O4/c1-2-30-13-5-3-4-12(16(13)27)18-23-14(17(22)28)15-19(25-18)26(20(29)24-15)11-8-6-10(21)7-9-11/h3-9,27H,2H2,1H3,(H2,22,28)(H,24,29) |
| InChIKey | LUAVFQZHEIREGQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.83 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |